C4H12ClN5 — CID 176525164
2-carbamimidoyl-1,1-bis(trideuteriomethyl)guanidine;hydrochloride (PubChem CID 176525164) has the molecular formula C4H12ClN5 and a molecular weight of 171.66 g/mol. Its IUPAC name is 2-carbamimidoyl-1,1-bis(trideuteriomethyl)guanidine;hydrochloride.
| Compound Name | 2-carbamimidoyl-1,1-bis(trideuteriomethyl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 176525164 |
| Molecular Formula | C4H12ClN5 |
| Molecular Weight | 171.66 g/mol |
| Exact Mass | 171.12 |
| IUPAC Name | 2-carbamimidoyl-1,1-bis(trideuteriomethyl)guanidine;hydrochloride |
| SMILES | Cl.[H]/N=C(N)/N=C(\N)N(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C4H11N5.ClH/c1-9(2)4(7)8-3(5)6;/h1-2H3,(H5,5,6,7,8);1H/i1D3,2D3; |
| InChIKey | OETHQSJEHLVLGH-TXHXQZCNSA-N |
| XLogP | -0.82 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.66 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|