C16H36ClN5 — CID 176529990
2-carbamimidoyl-1-methyl-1-tridecylguanidine;hydrochloride (PubChem CID 176529990) has the molecular formula C16H36ClN5 and a molecular weight of 333.95 g/mol. Its IUPAC name is 2-carbamimidoyl-1-methyl-1-tridecylguanidine;hydrochloride.
| Compound Name | 2-carbamimidoyl-1-methyl-1-tridecylguanidine;hydrochloride |
|---|---|
| PubChem CID | 176529990 |
| Molecular Formula | C16H36ClN5 |
| Molecular Weight | 333.95 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | 2-carbamimidoyl-1-methyl-1-tridecylguanidine;hydrochloride |
| SMILES | Cl.[H]/N=C(N)/N=C(\N)N(C)CCCCCCCCCCCCC |
| InChI | InChI=1S/C16H35N5.ClH/c1-3-4-5-6-7-8-9-10-11-12-13-14-21(2)16(19)20-15(17)18;/h3-14H2,1-2H3,(H5,17,18,19,20);1H |
| InChIKey | RGSMKLWDIAFRBI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.95 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|