C6H12F3N5 — CID 176546898
2-carbamimidoyl-1-methyl-1-(3,3,3-trifluoropropyl)guanidine (PubChem CID 176546898) has the molecular formula C6H12F3N5 and a molecular weight of 211.19 g/mol. Its IUPAC name is 2-carbamimidoyl-1-methyl-1-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-carbamimidoyl-1-methyl-1-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 176546898 |
| Molecular Formula | C6H12F3N5 |
| Molecular Weight | 211.19 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-carbamimidoyl-1-methyl-1-(3,3,3-trifluoropropyl)guanidine |
| SMILES | [H]/N=C(N)/N=C(\N)N(C)CCC(F)(F)F |
| InChI | InChI=1S/C6H12F3N5/c1-14(3-2-6(7,8)9)5(12)13-4(10)11/h2-3H2,1H3,(H5,10,11,12,13) |
| InChIKey | XEGIAAYSTYNJMK-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.19 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|