C6H18ClN5O — CID 176531718
2-carbamimidoyl-1,1-dimethylguanidine;ethanol;hydrochloride (PubChem CID 176531718) has the molecular formula C6H18ClN5O and a molecular weight of 211.70 g/mol. Its IUPAC name is 2-carbamimidoyl-1,1-dimethylguanidine;ethanol;hydrochloride.
| Compound Name | 2-carbamimidoyl-1,1-dimethylguanidine;ethanol;hydrochloride |
|---|---|
| PubChem CID | 176531718 |
| Molecular Formula | C6H18ClN5O |
| Molecular Weight | 211.70 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-carbamimidoyl-1,1-dimethylguanidine;ethanol;hydrochloride |
| SMILES | CCO.Cl.[H]/N=C(\N)N=C(N)N(C)C |
| InChI | InChI=1S/C4H11N5.C2H6O.ClH/c1-9(2)4(7)8-3(5)6;1-2-3;/h1-2H3,(H5,5,6,7,8);3H,2H2,1H3;1H |
| InChIKey | FWEUOICXFXPXSH-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.70 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|