C13H24N6O — CID 176541547
2-amino-3-phenylpropan-1-ol;2-carbamimidoyl-1,1-dimethylguanidine (PubChem CID 176541547) has the molecular formula C13H24N6O and a molecular weight of 280.38 g/mol. Its IUPAC name is 2-amino-3-phenylpropan-1-ol;2-carbamimidoyl-1,1-dimethylguanidine.
| Compound Name | 2-amino-3-phenylpropan-1-ol;2-carbamimidoyl-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 176541547 |
| Molecular Formula | C13H24N6O |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 2-amino-3-phenylpropan-1-ol;2-carbamimidoyl-1,1-dimethylguanidine |
| SMILES | NC(CO)Cc1ccccc1.[H]/N=C(\N)N=C(N)N(C)C |
| InChI | InChI=1S/C9H13NO.C4H11N5/c10-9(7-11)6-8-4-2-1-3-5-8;1-9(2)4(7)8-3(5)6/h1-5,9,11H,6-7,10H2;1-2H3,(H5,5,6,7,8) |
| InChIKey | YCGVXNRGPTWARH-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|