C30H37F2N7 — CID 176541468
1-[bis(4-fluorophenyl)methyl]-4-[(E)-3-phenylprop-2-enyl]piperazine;2-carbamimidoyl-1,1-dimethylguanidine (PubChem CID 176541468) has the molecular formula C30H37F2N7 and a molecular weight of 533.67 g/mol. Its IUPAC name is 1-[bis(4-fluorophenyl)methyl]-4-[(E)-3-phenylprop-2-enyl]piperazine;2-carbamimidoyl-1,1-dimethylguanidine.
| Compound Name | 1-[bis(4-fluorophenyl)methyl]-4-[(E)-3-phenylprop-2-enyl]piperazine;2-carbamimidoyl-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 176541468 |
| Molecular Formula | C30H37F2N7 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | 1-[bis(4-fluorophenyl)methyl]-4-[(E)-3-phenylprop-2-enyl]piperazine;2-carbamimidoyl-1,1-dimethylguanidine |
| SMILES | Fc1ccc(C(c2ccc(F)cc2)N2CCN(C/C=C/c3ccccc3)CC2)cc1.[H]/N=C(\N)N=C(N)N(C)C |
| InChI | InChI=1S/C26H26F2N2.C4H11N5/c27-24-12-8-22(9-13-24)26(23-10-14-25(28)15-11-23)30-19-17-29(18-20-30)16-4-7-21-5-2-1-3-6-21;1-9(2)4(7)8-3(5)6/h1-15,26H,16-20H2;1-2H3,(H5,5,6,7,8)/b7-4+; |
| InChIKey | HYIAWPAHZQQGGN-KQGICBIGSA-N |
| XLogP | 4.14 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|