C23H27FN2O3 — CID 90898771
2-[4-[4-[(R)-(4-fluorophenyl)-phenylmethyl]piperazin-1-yl]but-2-enoxy]acetic acid (PubChem CID 90898771) has the molecular formula C23H27FN2O3 and a molecular weight of 398.48 g/mol. Its IUPAC name is 2-[4-[4-[(R)-(4-fluorophenyl)-phenylmethyl]piperazin-1-yl]but-2-enoxy]acetic acid.
| Compound Name | 2-[4-[4-[(R)-(4-fluorophenyl)-phenylmethyl]piperazin-1-yl]but-2-enoxy]acetic acid |
|---|---|
| PubChem CID | 90898771 |
| Molecular Formula | C23H27FN2O3 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 2-[4-[4-[(R)-(4-fluorophenyl)-phenylmethyl]piperazin-1-yl]but-2-enoxy]acetic acid |
| SMILES | O=C(O)COCC=CCN1CCN([C@H](c2ccccc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H27FN2O3/c24-21-10-8-20(9-11-21)23(19-6-2-1-3-7-19)26-15-13-25(14-16-26)12-4-5-17-29-18-22(27)28/h1-11,23H,12-18H2,(H,27,28)/t23-/m1/s1 |
| InChIKey | URCCTDRTEHKTGQ-HSZRJFAPSA-N |
| XLogP | 3.19 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|