C24H30Cl2F2N2O3 — CID 66917950
methyl 2-[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]but-2-enoxy]acetate;dihydrochloride (PubChem CID 66917950) has the molecular formula C24H30Cl2F2N2O3 and a molecular weight of 503.42 g/mol. Its IUPAC name is methyl 2-[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]but-2-enoxy]acetate;dihydrochloride.
| Compound Name | methyl 2-[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]but-2-enoxy]acetate;dihydrochloride |
|---|---|
| PubChem CID | 66917950 |
| Molecular Formula | C24H30Cl2F2N2O3 |
| Molecular Weight | 503.42 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | methyl 2-[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]but-2-enoxy]acetate;dihydrochloride |
| SMILES | COC(=O)COCC=CCN1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C24H28F2N2O3.2ClH/c1-30-23(29)18-31-17-3-2-12-27-13-15-28(16-14-27)24(19-4-8-21(25)9-5-19)20-6-10-22(26)11-7-20;;/h2-11,24H,12-18H2,1H3;2*1H |
| InChIKey | YBKUBYFAWBBQMW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|