About 2-amino-3-phenylpropan-1-ol;butan-1-ol
2-amino-3-phenylpropan-1-ol;butan-1-ol (PubChem CID 174635361) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is 2-amino-3-phenylpropan-1-ol;butan-1-ol.
Molecular Properties
| Compound Name | 2-amino-3-phenylpropan-1-ol;butan-1-ol |
| PubChem CID | 174635361 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 2-amino-3-phenylpropan-1-ol;butan-1-ol |
| SMILES | CCCCO.NC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C9H13NO.C4H10O/c10-9(7-11)6-8-4-2-1-3-5-8;1-2-3-4-5/h1-5,9,11H,6-7,10H2;5H,2-4H2,1H3 |
| InChIKey | RFLFIHBGJHMJCH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-3-phenylpropan-1-ol;butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-phenylpropan-1-ol;butan-1-ol?
The IUPAC name of 2-amino-3-phenylpropan-1-ol;butan-1-ol (CID 174635361) is 2-amino-3-phenylpropan-1-ol;butan-1-ol.
What is the SMILES notation for 2-amino-3-phenylpropan-1-ol;butan-1-ol?
The canonical SMILES for 2-amino-3-phenylpropan-1-ol;butan-1-ol is CCCCO.NC(CO)Cc1ccccc1.
What is the InChIKey of 2-amino-3-phenylpropan-1-ol;butan-1-ol?
The InChIKey is RFLFIHBGJHMJCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO.C4H10O/c10-9(7-11)6-8-4-2-1-3-5-8;1-2-3-4-5/h1-5,9,11H,6-7,10H2;5H,2-4H2,1H3.
What are the key properties of 2-amino-3-phenylpropan-1-ol;butan-1-ol?
2-amino-3-phenylpropan-1-ol;butan-1-ol has a molecular weight of 225.33 g/mol, XLogP of 1.33, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-phenylpropan-1-ol;butan-1-ol is sourced from PubChem (CID 174635361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).