C10H15NO2 — CID 11789833
(2S,3R)-3-amino-4-phenylbutane-1,2-diol (PubChem CID 11789833) has the molecular formula C10H15NO2 and a molecular weight of 181.24 g/mol. Its IUPAC name is (2S,3R)-3-amino-4-phenylbutane-1,2-diol.
| Compound Name | (2S,3R)-3-amino-4-phenylbutane-1,2-diol |
|---|---|
| PubChem CID | 11789833 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (2S,3R)-3-amino-4-phenylbutane-1,2-diol |
| SMILES | N[C@H](Cc1ccccc1)[C@H](O)CO |
| InChI | InChI=1S/C10H15NO2/c11-9(10(13)7-12)6-8-4-2-1-3-5-8/h1-5,9-10,12-13H,6-7,11H2/t9-,10-/m1/s1 |
| InChIKey | YXQDBEZPBMCYAI-NXEZZACHSA-N |
| XLogP | -0.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |