C9H23ClN6O2 — CID 176527635
(2S)-2-amino-3-methylbutanoic acid;2-carbamimidoyl-1,1-dimethylguanidine;hydrochloride (PubChem CID 176527635) has the molecular formula C9H23ClN6O2 and a molecular weight of 282.78 g/mol. Its IUPAC name is (2S)-2-amino-3-methylbutanoic acid;2-carbamimidoyl-1,1-dimethylguanidine;hydrochloride.
| Compound Name | (2S)-2-amino-3-methylbutanoic acid;2-carbamimidoyl-1,1-dimethylguanidine;hydrochloride |
|---|---|
| PubChem CID | 176527635 |
| Molecular Formula | C9H23ClN6O2 |
| Molecular Weight | 282.78 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (2S)-2-amino-3-methylbutanoic acid;2-carbamimidoyl-1,1-dimethylguanidine;hydrochloride |
| SMILES | CC(C)[C@H](N)C(=O)O.Cl.[H]/N=C(\N)N=C(N)N(C)C |
| InChI | InChI=1S/C5H11NO2.C4H11N5.ClH/c1-3(2)4(6)5(7)8;1-9(2)4(7)8-3(5)6;/h3-4H,6H2,1-2H3,(H,7,8);1-2H3,(H5,5,6,7,8);1H/t4-;;/m0../s1 |
| InChIKey | FOZAXHZURTVVSX-FHNDMYTFSA-N |
| XLogP | -0.77 |
| TPSA | 154.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.78 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|