C6H16ClN5 — CID 176525900
2-carbamimidoyl-1,1-dimethylguanidine;ethene;hydrochloride (PubChem CID 176525900) has the molecular formula C6H16ClN5 and a molecular weight of 193.68 g/mol. Its IUPAC name is 2-carbamimidoyl-1,1-dimethylguanidine;ethene;hydrochloride.
| Compound Name | 2-carbamimidoyl-1,1-dimethylguanidine;ethene;hydrochloride |
|---|---|
| PubChem CID | 176525900 |
| Molecular Formula | C6H16ClN5 |
| Molecular Weight | 193.68 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-carbamimidoyl-1,1-dimethylguanidine;ethene;hydrochloride |
| SMILES | C=C.Cl.[H]/N=C(\N)N=C(N)N(C)C |
| InChI | InChI=1S/C4H11N5.C2H4.ClH/c1-9(2)4(7)8-3(5)6;1-2;/h1-2H3,(H5,5,6,7,8);1-2H2;1H |
| InChIKey | BZIHJVYBHZXITI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.68 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|