C9H20ClN5 — CID 176518469
2-carbamimidoyl-1-cyclohexyl-1-methylguanidine;hydrochloride (PubChem CID 176518469) has the molecular formula C9H20ClN5 and a molecular weight of 233.75 g/mol. Its IUPAC name is 2-carbamimidoyl-1-cyclohexyl-1-methylguanidine;hydrochloride.
| Compound Name | 2-carbamimidoyl-1-cyclohexyl-1-methylguanidine;hydrochloride |
|---|---|
| PubChem CID | 176518469 |
| Molecular Formula | C9H20ClN5 |
| Molecular Weight | 233.75 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2-carbamimidoyl-1-cyclohexyl-1-methylguanidine;hydrochloride |
| SMILES | Cl.[H]/N=C(N)/N=C(\N)N(C)C1CCCCC1 |
| InChI | InChI=1S/C9H19N5.ClH/c1-14(9(12)13-8(10)11)7-5-3-2-4-6-7;/h7H,2-6H2,1H3,(H5,10,11,12,13);1H |
| InChIKey | TZKNEKPRISXMLM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.75 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|