C9H20N6 — CID 176547017
N'-carbamimidoyl-3-(dimethylamino)piperidine-1-carboximidamide (PubChem CID 176547017) has the molecular formula C9H20N6 and a molecular weight of 212.30 g/mol. Its IUPAC name is N'-carbamimidoyl-3-(dimethylamino)piperidine-1-carboximidamide.
| Compound Name | N'-carbamimidoyl-3-(dimethylamino)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 176547017 |
| Molecular Formula | C9H20N6 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.17 |
| IUPAC Name | N'-carbamimidoyl-3-(dimethylamino)piperidine-1-carboximidamide |
| SMILES | [H]/N=C(N)/N=C(\N)N1CCCC(N(C)C)C1 |
| InChI | InChI=1S/C9H20N6/c1-14(2)7-4-3-5-15(6-7)9(12)13-8(10)11/h7H,3-6H2,1-2H3,(H5,10,11,12,13) |
| InChIKey | IMYSNPCOIHPXCJ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|