About bis(N'-carbamimidoylpiperidine-1-carboximidamide);sulfuric acid
bis(N'-carbamimidoylpiperidine-1-carboximidamide);sulfuric acid (PubChem CID 176522883) has the molecular formula C14H32N10O4S
and a molecular weight of 436.54 g/mol. Its IUPAC name is bis(N'-carbamimidoylpiperidine-1-carboximidamide);sulfuric acid.
Molecular Properties
| Compound Name | bis(N'-carbamimidoylpiperidine-1-carboximidamide);sulfuric acid |
| PubChem CID | 176522883 |
| Molecular Formula | C14H32N10O4S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | bis(N'-carbamimidoylpiperidine-1-carboximidamide);sulfuric acid |
| SMILES | O=S(=O)(O)O.[H]/N=C(N)/N=C(\N)N1CCCCC1.[H]/N=C(N)/N=C(\N)N1CCCCC1 |
| InChI | InChI=1S/2C7H15N5.H2O4S/c2*8-6(9)11-7(10)12-4-2-1-3-5-12;1-5(2,3)4/h2*1-5H2,(H5,8,9,10,11);(H2,1,2,3,4) |
| InChIKey | ZKGIKLOAEZLKPA-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 257.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(N'-carbamimidoylpiperidine-1-carboximidamide);sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N'-carbamimidoylpiperidine-1-carboximidamide);sulfuric acid?
The IUPAC name of bis(N'-carbamimidoylpiperidine-1-carboximidamide);sulfuric acid (CID 176522883) is bis(N'-carbamimidoylpiperidine-1-carboximidamide);sulfuric acid.
What is the SMILES notation for bis(N'-carbamimidoylpiperidine-1-carboximidamide);sulfuric acid?
The canonical SMILES for bis(N'-carbamimidoylpiperidine-1-carboximidamide);sulfuric acid is O=S(=O)(O)O.[H]/N=C(N)/N=C(\N)N1CCCCC1.[H]/N=C(N)/N=C(\N)N1CCCCC1.
What is the InChIKey of bis(N'-carbamimidoylpiperidine-1-carboximidamide);sulfuric acid?
The InChIKey is ZKGIKLOAEZLKPA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H15N5.H2O4S/c2*8-6(9)11-7(10)12-4-2-1-3-5-12;1-5(2,3)4/h2*1-5H2,(H5,8,9,10,11);(H2,1,2,3,4).
What are the key properties of bis(N'-carbamimidoylpiperidine-1-carboximidamide);sulfuric acid?
bis(N'-carbamimidoylpiperidine-1-carboximidamide);sulfuric acid has a molecular weight of 436.54 g/mol, XLogP of -1.29, 0 rotatable bonds, 8 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N'-carbamimidoylpiperidine-1-carboximidamide);sulfuric acid is sourced from PubChem (CID 176522883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).