C14H32N10O4S — CID 176522883
bis(N'-carbamimidoylpiperidine-1-carboximidamide);sulfuric acid (PubChem CID 176522883) has the molecular formula C14H32N10O4S and a molecular weight of 436.54 g/mol. Its IUPAC name is bis(N'-carbamimidoylpiperidine-1-carboximidamide);sulfuric acid.
| Compound Name | bis(N'-carbamimidoylpiperidine-1-carboximidamide);sulfuric acid |
|---|---|
| PubChem CID | 176522883 |
| Molecular Formula | C14H32N10O4S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | bis(N'-carbamimidoylpiperidine-1-carboximidamide);sulfuric acid |
| SMILES | O=S(=O)(O)O.[H]/N=C(N)/N=C(\N)N1CCCCC1.[H]/N=C(N)/N=C(\N)N1CCCCC1 |
| InChI | InChI=1S/2C7H15N5.H2O4S/c2*8-6(9)11-7(10)12-4-2-1-3-5-12;1-5(2,3)4/h2*1-5H2,(H5,8,9,10,11);(H2,1,2,3,4) |
| InChIKey | ZKGIKLOAEZLKPA-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 257.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|