C13H20ClN5O3S — CID 156631539
4-[[amino-[(Z)-[amino(piperidin-1-yl)methylidene]amino]methylidene]amino]benzenesulfonic acid;hydrochloride (PubChem CID 156631539) has the molecular formula C13H20ClN5O3S and a molecular weight of 361.86 g/mol. Its IUPAC name is 4-[[amino-[(Z)-[amino(piperidin-1-yl)methylidene]amino]methylidene]amino]benzenesulfonic acid;hydrochloride.
| Compound Name | 4-[[amino-[(Z)-[amino(piperidin-1-yl)methylidene]amino]methylidene]amino]benzenesulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 156631539 |
| Molecular Formula | C13H20ClN5O3S |
| Molecular Weight | 361.86 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 4-[[amino-[(Z)-[amino(piperidin-1-yl)methylidene]amino]methylidene]amino]benzenesulfonic acid;hydrochloride |
| SMILES | Cl.N/C(=N/C(N)=N/c1ccc(S(=O)(=O)O)cc1)N1CCCCC1 |
| InChI | InChI=1S/C13H19N5O3S.ClH/c14-12(17-13(15)18-8-2-1-3-9-18)16-10-4-6-11(7-5-10)22(19,20)21;/h4-7H,1-3,8-9H2,(H,19,20,21)(H4,14,15,16,17);1H |
| InChIKey | FBSCDQWBTPUPJI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.86 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|