C12H18N6 — CID 154058076
N'-[N'-(4-aminophenyl)carbamimidoyl]pyrrolidine-1-carboximidamide (PubChem CID 154058076) has the molecular formula C12H18N6 and a molecular weight of 246.32 g/mol. Its IUPAC name is N'-[N'-(4-aminophenyl)carbamimidoyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-[N'-(4-aminophenyl)carbamimidoyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 154058076 |
| Molecular Formula | C12H18N6 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | N'-[N'-(4-aminophenyl)carbamimidoyl]pyrrolidine-1-carboximidamide |
| SMILES | NC(=N/C(N)=N/c1ccc(N)cc1)N1CCCC1 |
| InChI | InChI=1S/C12H18N6/c13-9-3-5-10(6-4-9)16-11(14)17-12(15)18-7-1-2-8-18/h3-6H,1-2,7-8,13H2,(H4,14,15,16,17) |
| InChIKey | FXNWNRSAZIHGBL-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|