C14H22ClN5S — CID 141426691
N'-[N'-(4-methylsulfanylphenyl)carbamimidoyl]piperidine-1-carboximidamide;hydrochloride (PubChem CID 141426691) has the molecular formula C14H22ClN5S and a molecular weight of 327.88 g/mol. Its IUPAC name is N'-[N'-(4-methylsulfanylphenyl)carbamimidoyl]piperidine-1-carboximidamide;hydrochloride.
| Compound Name | N'-[N'-(4-methylsulfanylphenyl)carbamimidoyl]piperidine-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 141426691 |
| Molecular Formula | C14H22ClN5S |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N'-[N'-(4-methylsulfanylphenyl)carbamimidoyl]piperidine-1-carboximidamide;hydrochloride |
| SMILES | CSc1ccc(/N=C(N)/N=C(/N)N2CCCCC2)cc1.Cl |
| InChI | InChI=1S/C14H21N5S.ClH/c1-20-12-7-5-11(6-8-12)17-13(15)18-14(16)19-9-3-2-4-10-19;/h5-8H,2-4,9-10H2,1H3,(H4,15,16,17,18);1H |
| InChIKey | YOPPOSUVUNMGBV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|