C12H16BrN5 — CID 154012553
N'-[N'-(4-bromophenyl)carbamimidoyl]pyrrolidine-1-carboximidamide (PubChem CID 154012553) has the molecular formula C12H16BrN5 and a molecular weight of 310.20 g/mol. Its IUPAC name is N'-[N'-(4-bromophenyl)carbamimidoyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-[N'-(4-bromophenyl)carbamimidoyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 154012553 |
| Molecular Formula | C12H16BrN5 |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | N'-[N'-(4-bromophenyl)carbamimidoyl]pyrrolidine-1-carboximidamide |
| SMILES | NC(=N/C(N)=N/c1ccc(Br)cc1)N1CCCC1 |
| InChI | InChI=1S/C12H16BrN5/c13-9-3-5-10(6-4-9)16-11(14)17-12(15)18-7-1-2-8-18/h3-6H,1-2,7-8H2,(H4,14,15,16,17) |
| InChIKey | DXCUYAKBJGYMFK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|