C13H18Cl3N5 — CID 172705203
N'-[N'-(3,5-dichlorophenyl)carbamimidoyl]piperidine-1-carboximidamide;hydrochloride (PubChem CID 172705203) has the molecular formula C13H18Cl3N5 and a molecular weight of 350.68 g/mol. Its IUPAC name is N'-[N'-(3,5-dichlorophenyl)carbamimidoyl]piperidine-1-carboximidamide;hydrochloride.
| Compound Name | N'-[N'-(3,5-dichlorophenyl)carbamimidoyl]piperidine-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 172705203 |
| Molecular Formula | C13H18Cl3N5 |
| Molecular Weight | 350.68 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | N'-[N'-(3,5-dichlorophenyl)carbamimidoyl]piperidine-1-carboximidamide;hydrochloride |
| SMILES | Cl.NC(=N/C(N)=N/c1cc(Cl)cc(Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C13H17Cl2N5.ClH/c14-9-6-10(15)8-11(7-9)18-12(16)19-13(17)20-4-2-1-3-5-20;/h6-8H,1-5H2,(H4,16,17,18,19);1H |
| InChIKey | DMLBBZYWAINJGC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.68 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|