C11H14ClN3 — CID 89339520
N'-(3-chlorophenyl)pyrrolidine-1-carboximidamide (PubChem CID 89339520) has the molecular formula C11H14ClN3 and a molecular weight of 223.71 g/mol. Its IUPAC name is N'-(3-chlorophenyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-(3-chlorophenyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 89339520 |
| Molecular Formula | C11H14ClN3 |
| Molecular Weight | 223.71 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | N'-(3-chlorophenyl)pyrrolidine-1-carboximidamide |
| SMILES | N/C(=N\c1cccc(Cl)c1)N1CCCC1 |
| InChI | InChI=1S/C11H14ClN3/c12-9-4-3-5-10(8-9)14-11(13)15-6-1-2-7-15/h3-5,8H,1-2,6-7H2,(H2,13,14) |
| InChIKey | SRWIFWYZFGYLEI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.71 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|