C12H17ClN2 — CID 67032180
N'-(3-chlorophenyl)-3,3-dimethylbutanimidamide (PubChem CID 67032180) has the molecular formula C12H17ClN2 and a molecular weight of 224.74 g/mol. Its IUPAC name is N'-(3-chlorophenyl)-3,3-dimethylbutanimidamide.
| Compound Name | N'-(3-chlorophenyl)-3,3-dimethylbutanimidamide |
|---|---|
| PubChem CID | 67032180 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.74 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | N'-(3-chlorophenyl)-3,3-dimethylbutanimidamide |
| SMILES | CC(C)(C)C/C(N)=N/c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H17ClN2/c1-12(2,3)8-11(14)15-10-6-4-5-9(13)7-10/h4-7H,8H2,1-3H3,(H2,14,15) |
| InChIKey | RLEJRZCSXWBNGD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.74 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|