C15H15ClN2O — CID 129074919
N'-(3-chlorophenyl)-N-hydroxy-3-phenylpropanimidamide (PubChem CID 129074919) has the molecular formula C15H15ClN2O and a molecular weight of 274.75 g/mol. Its IUPAC name is N'-(3-chlorophenyl)-N-hydroxy-3-phenylpropanimidamide.
| Compound Name | N'-(3-chlorophenyl)-N-hydroxy-3-phenylpropanimidamide |
|---|---|
| PubChem CID | 129074919 |
| Molecular Formula | C15H15ClN2O |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | N'-(3-chlorophenyl)-N-hydroxy-3-phenylpropanimidamide |
| SMILES | ON/C(CCc1ccccc1)=N/c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H15ClN2O/c16-13-7-4-8-14(11-13)17-15(18-19)10-9-12-5-2-1-3-6-12/h1-8,11,19H,9-10H2,(H,17,18) |
| InChIKey | AJMDBTLOVPDLCT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|