C40H41Cl2N3OS — CID 159012818
N'-(3-chlorophenyl)-N-hydroxy-2-(4-phenylcyclohex-3-en-1-yl)ethanimidamide;N-(3-chlorophenyl)-2-(4-phenylcyclohex-3-en-1-yl)ethanethioamide (PubChem CID 159012818) has the molecular formula C40H41Cl2N3OS and a molecular weight of 682.76 g/mol. Its IUPAC name is N'-(3-chlorophenyl)-N-hydroxy-2-(4-phenylcyclohex-3-en-1-yl)ethanimidamide;N-(3-chlorophenyl)-2-(4-phenylcyclohex-3-en-1-yl)ethanethioamide.
| Compound Name | N'-(3-chlorophenyl)-N-hydroxy-2-(4-phenylcyclohex-3-en-1-yl)ethanimidamide;N-(3-chlorophenyl)-2-(4-phenylcyclohex-3-en-1-yl)ethanethioamide |
|---|---|
| PubChem CID | 159012818 |
| Molecular Formula | C40H41Cl2N3OS |
| Molecular Weight | 682.76 g/mol |
| Exact Mass | 681.23 |
| IUPAC Name | N'-(3-chlorophenyl)-N-hydroxy-2-(4-phenylcyclohex-3-en-1-yl)ethanimidamide;N-(3-chlorophenyl)-2-(4-phenylcyclohex-3-en-1-yl)ethanethioamide |
| SMILES | ON/C(CC1CC=C(c2ccccc2)CC1)=N\c1cccc(Cl)c1.S=C(CC1CC=C(c2ccccc2)CC1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H21ClN2O.C20H20ClNS/c21-18-7-4-8-19(14-18)22-20(23-24)13-15-9-11-17(12-10-15)16-5-2-1-3-6-16;21-18-7-4-8-19(14-18)22-20(23)13-15-9-11-17(12-10-15)16-5-2-1-3-6-16/h1-8,11,14-15,24H,9-10,12-13H2,(H,22,23);1-8,11,14-15H,9-10,12-13H2,(H,22,23) |
| InChIKey | JSSCCSAXGRVERU-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.76 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|