C20H22ClNOS — CID 118569589
N-(3-chlorophenyl)-2-[4-(4-hydroxyphenyl)cyclohexyl]ethanethioamide (PubChem CID 118569589) has the molecular formula C20H22ClNOS and a molecular weight of 359.92 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[4-(4-hydroxyphenyl)cyclohexyl]ethanethioamide.
| Compound Name | N-(3-chlorophenyl)-2-[4-(4-hydroxyphenyl)cyclohexyl]ethanethioamide |
|---|---|
| PubChem CID | 118569589 |
| Molecular Formula | C20H22ClNOS |
| Molecular Weight | 359.92 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N-(3-chlorophenyl)-2-[4-(4-hydroxyphenyl)cyclohexyl]ethanethioamide |
| SMILES | Oc1ccc(C2CCC(CC(=S)Nc3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C20H22ClNOS/c21-17-2-1-3-18(13-17)22-20(24)12-14-4-6-15(7-5-14)16-8-10-19(23)11-9-16/h1-3,8-11,13-15,23H,4-7,12H2,(H,22,24) |
| InChIKey | YQBWYIZMHWFVCG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.92 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|