C11H13ClN4S2 — CID 8742162
1-(3-chlorophenyl)-3-(cyclopropylcarbamothioylamino)thiourea (PubChem CID 8742162) has the molecular formula C11H13ClN4S2 and a molecular weight of 300.84 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(cyclopropylcarbamothioylamino)thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-(cyclopropylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 8742162 |
| Molecular Formula | C11H13ClN4S2 |
| Molecular Weight | 300.84 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(cyclopropylcarbamothioylamino)thiourea |
| SMILES | S=C(NNC(=S)NC1CC1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H13ClN4S2/c12-7-2-1-3-9(6-7)14-11(18)16-15-10(17)13-8-4-5-8/h1-3,6,8H,4-5H2,(H2,13,15,17)(H2,14,16,18) |
| InChIKey | MWTVANZFMAVDRG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.84 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|