C21H30ClN3S — CID 3218031
1-(3-chlorophenyl)-3-(9-cyclohexyl-9-azabicyclo[3.3.1]nonan-3-yl)thiourea (PubChem CID 3218031) has the molecular formula C21H30ClN3S and a molecular weight of 392.01 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(9-cyclohexyl-9-azabicyclo[3.3.1]nonan-3-yl)thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-(9-cyclohexyl-9-azabicyclo[3.3.1]nonan-3-yl)thiourea |
|---|---|
| PubChem CID | 3218031 |
| Molecular Formula | C21H30ClN3S |
| Molecular Weight | 392.01 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(9-cyclohexyl-9-azabicyclo[3.3.1]nonan-3-yl)thiourea |
| SMILES | S=C(Nc1cccc(Cl)c1)NC1CC2CCCC(C1)N2C1CCCCC1 |
| InChI | InChI=1S/C21H30ClN3S/c22-15-6-4-7-16(12-15)23-21(26)24-17-13-19-10-5-11-20(14-17)25(19)18-8-2-1-3-9-18/h4,6-7,12,17-20H,1-3,5,8-11,13-14H2,(H2,23,24,26) |
| InChIKey | OUMXGEOHCOTNFV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.01 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|