C20H28ClN3O — CID 1461552
1-(3-chlorophenyl)-3-[(1S,5R)-9-cyclopentyl-9-azabicyclo[3.3.1]nonan-3-yl]urea (PubChem CID 1461552) has the molecular formula C20H28ClN3O and a molecular weight of 361.92 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(1S,5R)-9-cyclopentyl-9-azabicyclo[3.3.1]nonan-3-yl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(1S,5R)-9-cyclopentyl-9-azabicyclo[3.3.1]nonan-3-yl]urea |
|---|---|
| PubChem CID | 1461552 |
| Molecular Formula | C20H28ClN3O |
| Molecular Weight | 361.92 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(1S,5R)-9-cyclopentyl-9-azabicyclo[3.3.1]nonan-3-yl]urea |
| SMILES | O=C(Nc1cccc(Cl)c1)NC1C[C@H]2CCC[C@@H](C1)N2C1CCCC1 |
| InChI | InChI=1S/C20H28ClN3O/c21-14-5-3-6-15(11-14)22-20(25)23-16-12-18-9-4-10-19(13-16)24(18)17-7-1-2-8-17/h3,5-6,11,16-19H,1-2,4,7-10,12-13H2,(H2,22,23,25)/t16?,18-,19+ |
| InChIKey | UIEFKNAMTXQZBL-JLYLLQBASA-N |
| XLogP | 4.79 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.92 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |