C21H31N3O — CID 1461622
1-[(1R,5R)-9-cyclohexyl-9-azabicyclo[3.3.1]nonan-3-yl]-3-phenylurea (PubChem CID 1461622) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is 1-[(1R,5R)-9-cyclohexyl-9-azabicyclo[3.3.1]nonan-3-yl]-3-phenylurea.
| Compound Name | 1-[(1R,5R)-9-cyclohexyl-9-azabicyclo[3.3.1]nonan-3-yl]-3-phenylurea |
|---|---|
| PubChem CID | 1461622 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | 1-[(1R,5R)-9-cyclohexyl-9-azabicyclo[3.3.1]nonan-3-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)NC1C[C@H]2CCC[C@H](C1)N2C1CCCCC1 |
| InChI | InChI=1S/C21H31N3O/c25-21(22-16-8-3-1-4-9-16)23-17-14-19-12-7-13-20(15-17)24(19)18-10-5-2-6-11-18/h1,3-4,8-9,17-20H,2,5-7,10-15H2,(H2,22,23,25)/t19-,20-/m1/s1 |
| InChIKey | XIAFPZIVHUAQLJ-WOJBJXKFSA-N |
| XLogP | 4.53 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |