C22H33N3O — CID 5158438
1-(8-cyclopentyl-8-azabicyclo[3.2.1]octan-3-yl)-3-(4-propan-2-ylphenyl)urea (PubChem CID 5158438) has the molecular formula C22H33N3O and a molecular weight of 355.53 g/mol. Its IUPAC name is 1-(8-cyclopentyl-8-azabicyclo[3.2.1]octan-3-yl)-3-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-(8-cyclopentyl-8-azabicyclo[3.2.1]octan-3-yl)-3-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 5158438 |
| Molecular Formula | C22H33N3O |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | 1-(8-cyclopentyl-8-azabicyclo[3.2.1]octan-3-yl)-3-(4-propan-2-ylphenyl)urea |
| SMILES | CC(C)c1ccc(NC(=O)NC2CC3CCC(C2)N3C2CCCC2)cc1 |
| InChI | InChI=1S/C22H33N3O/c1-15(2)16-7-9-17(10-8-16)23-22(26)24-18-13-20-11-12-21(14-18)25(20)19-5-3-4-6-19/h7-10,15,18-21H,3-6,11-14H2,1-2H3,(H2,23,24,26) |
| InChIKey | MXBJNLJZUBYWEO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |