C18H24ClN3S — CID 1461288
1-(2-chlorophenyl)-3-[(1S,5S)-9-cyclopropyl-9-azabicyclo[3.3.1]nonan-3-yl]thiourea (PubChem CID 1461288) has the molecular formula C18H24ClN3S and a molecular weight of 349.93 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[(1S,5S)-9-cyclopropyl-9-azabicyclo[3.3.1]nonan-3-yl]thiourea.
| Compound Name | 1-(2-chlorophenyl)-3-[(1S,5S)-9-cyclopropyl-9-azabicyclo[3.3.1]nonan-3-yl]thiourea |
|---|---|
| PubChem CID | 1461288 |
| Molecular Formula | C18H24ClN3S |
| Molecular Weight | 349.93 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[(1S,5S)-9-cyclopropyl-9-azabicyclo[3.3.1]nonan-3-yl]thiourea |
| SMILES | S=C(Nc1ccccc1Cl)NC1C[C@@H]2CCC[C@@H](C1)N2C1CC1 |
| InChI | InChI=1S/C18H24ClN3S/c19-16-6-1-2-7-17(16)21-18(23)20-12-10-14-4-3-5-15(11-12)22(14)13-8-9-13/h1-2,6-7,12-15H,3-5,8-11H2,(H2,20,21,23)/t14-,15-/m0/s1 |
| InChIKey | DFOWZBIOZHJFNW-GJZGRUSLSA-N |
| XLogP | 4.17 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.93 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|