C22H33N3S — CID 1461594
1-[(1S,5R)-9-cyclopentyl-9-azabicyclo[3.3.1]nonan-3-yl]-3-(2,3-dimethylphenyl)thiourea (PubChem CID 1461594) has the molecular formula C22H33N3S and a molecular weight of 371.59 g/mol. Its IUPAC name is 1-[(1S,5R)-9-cyclopentyl-9-azabicyclo[3.3.1]nonan-3-yl]-3-(2,3-dimethylphenyl)thiourea.
| Compound Name | 1-[(1S,5R)-9-cyclopentyl-9-azabicyclo[3.3.1]nonan-3-yl]-3-(2,3-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 1461594 |
| Molecular Formula | C22H33N3S |
| Molecular Weight | 371.59 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | 1-[(1S,5R)-9-cyclopentyl-9-azabicyclo[3.3.1]nonan-3-yl]-3-(2,3-dimethylphenyl)thiourea |
| SMILES | Cc1cccc(NC(=S)NC2C[C@H]3CCC[C@@H](C2)N3C2CCCC2)c1C |
| InChI | InChI=1S/C22H33N3S/c1-15-7-5-12-21(16(15)2)24-22(26)23-17-13-19-10-6-11-20(14-17)25(19)18-8-3-4-9-18/h5,7,12,17-20H,3-4,6,8-11,13-14H2,1-2H3,(H2,23,24,26)/t17?,19-,20+ |
| InChIKey | ZLDIGORJNNGUCY-CTXDPNEZSA-N |
| XLogP | 4.92 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|