C23H35N3S — CID 1461642
1-[(1R,5S)-9-cyclohexyl-9-azabicyclo[3.3.1]nonan-3-yl]-3-(4-ethylphenyl)thiourea (PubChem CID 1461642) has the molecular formula C23H35N3S and a molecular weight of 385.62 g/mol. Its IUPAC name is 1-[(1R,5S)-9-cyclohexyl-9-azabicyclo[3.3.1]nonan-3-yl]-3-(4-ethylphenyl)thiourea.
| Compound Name | 1-[(1R,5S)-9-cyclohexyl-9-azabicyclo[3.3.1]nonan-3-yl]-3-(4-ethylphenyl)thiourea |
|---|---|
| PubChem CID | 1461642 |
| Molecular Formula | C23H35N3S |
| Molecular Weight | 385.62 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | 1-[(1R,5S)-9-cyclohexyl-9-azabicyclo[3.3.1]nonan-3-yl]-3-(4-ethylphenyl)thiourea |
| SMILES | CCc1ccc(NC(=S)NC2C[C@H]3CCC[C@@H](C2)N3C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H35N3S/c1-2-17-11-13-18(14-12-17)24-23(27)25-19-15-21-9-6-10-22(16-19)26(21)20-7-4-3-5-8-20/h11-14,19-22H,2-10,15-16H2,1H3,(H2,24,25,27)/t19?,21-,22+ |
| InChIKey | MJLDMLSOSZUVJK-XDNSSPFJSA-N |
| XLogP | 5.25 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|