C22H29N3S2 — CID 3218178
1-(4-ethylphenyl)-3-[9-(thiophen-2-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-yl]thiourea (PubChem CID 3218178) has the molecular formula C22H29N3S2 and a molecular weight of 399.63 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[9-(thiophen-2-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-yl]thiourea.
| Compound Name | 1-(4-ethylphenyl)-3-[9-(thiophen-2-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-yl]thiourea |
|---|---|
| PubChem CID | 3218178 |
| Molecular Formula | C22H29N3S2 |
| Molecular Weight | 399.63 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[9-(thiophen-2-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-yl]thiourea |
| SMILES | CCc1ccc(NC(=S)NC2CC3CCCC(C2)N3Cc2cccs2)cc1 |
| InChI | InChI=1S/C22H29N3S2/c1-2-16-8-10-17(11-9-16)23-22(26)24-18-13-19-5-3-6-20(14-18)25(19)15-21-7-4-12-27-21/h4,7-12,18-20H,2-3,5-6,13-15H2,1H3,(H2,23,24,26) |
| InChIKey | YULJENCEDMKCBO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.63 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|