C21H27N3OS2 — CID 98110318
1-(2-methoxyphenyl)-3-[(1S,5S)-9-(thiophen-2-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-yl]thiourea (PubChem CID 98110318) has the molecular formula C21H27N3OS2 and a molecular weight of 401.60 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[(1S,5S)-9-(thiophen-2-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-yl]thiourea.
| Compound Name | 1-(2-methoxyphenyl)-3-[(1S,5S)-9-(thiophen-2-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-yl]thiourea |
|---|---|
| PubChem CID | 98110318 |
| Molecular Formula | C21H27N3OS2 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[(1S,5S)-9-(thiophen-2-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-yl]thiourea |
| SMILES | COc1ccccc1NC(=S)NC1C[C@@H]2CCC[C@@H](C1)N2Cc1cccs1 |
| InChI | InChI=1S/C21H27N3OS2/c1-25-20-10-3-2-9-19(20)23-21(26)22-15-12-16-6-4-7-17(13-15)24(16)14-18-8-5-11-27-18/h2-3,5,8-11,15-17H,4,6-7,12-14H2,1H3,(H2,22,23,26)/t16-,17-/m0/s1 |
| InChIKey | ZLJLBEVCSPUQSM-IRXDYDNUSA-N |
| XLogP | 4.63 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|