C21H27N3OS2 — CID 3217294
1-(4-methylsulfanylphenyl)-3-[9-(thiophen-2-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-yl]urea (PubChem CID 3217294) has the molecular formula C21H27N3OS2 and a molecular weight of 401.60 g/mol. Its IUPAC name is 1-(4-methylsulfanylphenyl)-3-[9-(thiophen-2-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-yl]urea.
| Compound Name | 1-(4-methylsulfanylphenyl)-3-[9-(thiophen-2-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-yl]urea |
|---|---|
| PubChem CID | 3217294 |
| Molecular Formula | C21H27N3OS2 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 1-(4-methylsulfanylphenyl)-3-[9-(thiophen-2-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-yl]urea |
| SMILES | CSc1ccc(NC(=O)NC2CC3CCCC(C2)N3Cc2cccs2)cc1 |
| InChI | InChI=1S/C21H27N3OS2/c1-26-19-9-7-15(8-10-19)22-21(25)23-16-12-17-4-2-5-18(13-16)24(17)14-20-6-3-11-27-20/h3,6-11,16-18H,2,4-5,12-14H2,1H3,(H2,22,23,25) |
| InChIKey | ACCAAHMUGXFKMJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |