C20H25N3OS2 — CID 3217872
1-(4-methylsulfanylphenyl)-3-[8-(thiophen-2-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]urea (PubChem CID 3217872) has the molecular formula C20H25N3OS2 and a molecular weight of 387.57 g/mol. Its IUPAC name is 1-(4-methylsulfanylphenyl)-3-[8-(thiophen-2-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]urea.
| Compound Name | 1-(4-methylsulfanylphenyl)-3-[8-(thiophen-2-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]urea |
|---|---|
| PubChem CID | 3217872 |
| Molecular Formula | C20H25N3OS2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 1-(4-methylsulfanylphenyl)-3-[8-(thiophen-2-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]urea |
| SMILES | CSc1ccc(NC(=O)NC2CC3CCC(C2)N3Cc2cccs2)cc1 |
| InChI | InChI=1S/C20H25N3OS2/c1-25-18-8-4-14(5-9-18)21-20(24)22-15-11-16-6-7-17(12-15)23(16)13-19-3-2-10-26-19/h2-5,8-10,15-17H,6-7,11-13H2,1H3,(H2,21,22,24) |
| InChIKey | QRMKCOIXGCQWCD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |