C23H29N3OS — CID 98109952
1-[(1R,5R)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-ethoxyphenyl)thiourea (PubChem CID 98109952) has the molecular formula C23H29N3OS and a molecular weight of 395.57 g/mol. Its IUPAC name is 1-[(1R,5R)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-ethoxyphenyl)thiourea.
| Compound Name | 1-[(1R,5R)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 98109952 |
| Molecular Formula | C23H29N3OS |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 1-[(1R,5R)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-ethoxyphenyl)thiourea |
| SMILES | CCOc1ccccc1NC(=S)NC1C[C@H]2CC[C@H](C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C23H29N3OS/c1-2-27-22-11-7-6-10-21(22)25-23(28)24-18-14-19-12-13-20(15-18)26(19)16-17-8-4-3-5-9-17/h3-11,18-20H,2,12-16H2,1H3,(H2,24,25,28)/t19-,20-/m1/s1 |
| InChIKey | GQNWADDWAZLEBY-WOJBJXKFSA-N |
| XLogP | 4.57 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|