C23H29N3S — CID 7402527
1-[(1R,5S)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-phenylethyl)thiourea (PubChem CID 7402527) has the molecular formula C23H29N3S and a molecular weight of 379.57 g/mol. Its IUPAC name is 1-[(1R,5S)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-phenylethyl)thiourea.
| Compound Name | 1-[(1R,5S)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 7402527 |
| Molecular Formula | C23H29N3S |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 1-[(1R,5S)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-phenylethyl)thiourea |
| SMILES | S=C(NCCc1ccccc1)NC1C[C@H]2CC[C@@H](C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C23H29N3S/c27-23(24-14-13-18-7-3-1-4-8-18)25-20-15-21-11-12-22(16-20)26(21)17-19-9-5-2-6-10-19/h1-10,20-22H,11-17H2,(H2,24,25,27)/t20?,21-,22+ |
| InChIKey | VDNMALJFIDGEGE-FRIKZZABSA-N |
| XLogP | 3.89 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|