C22H27N3OS — CID 7389566
1-[(1R,5R)-8-[(4-methoxyphenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-phenylthiourea (PubChem CID 7389566) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is 1-[(1R,5R)-8-[(4-methoxyphenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-phenylthiourea.
| Compound Name | 1-[(1R,5R)-8-[(4-methoxyphenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-phenylthiourea |
|---|---|
| PubChem CID | 7389566 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1-[(1R,5R)-8-[(4-methoxyphenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-phenylthiourea |
| SMILES | COc1ccc(CN2[C@@H]3CC[C@@H]2CC(NC(=S)Nc2ccccc2)C3)cc1 |
| InChI | InChI=1S/C22H27N3OS/c1-26-21-11-7-16(8-12-21)15-25-19-9-10-20(25)14-18(13-19)24-22(27)23-17-5-3-2-4-6-17/h2-8,11-12,18-20H,9-10,13-15H2,1H3,(H2,23,24,27)/t19-,20-/m1/s1 |
| InChIKey | KRELVSDFEMXNCM-WOJBJXKFSA-N |
| XLogP | 4.18 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|