C23H28FN3S — CID 50937819
1-(2-ethylphenyl)-3-[(1R,5R)-8-[(4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]thiourea (PubChem CID 50937819) has the molecular formula C23H28FN3S and a molecular weight of 397.56 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-3-[(1R,5R)-8-[(4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]thiourea.
| Compound Name | 1-(2-ethylphenyl)-3-[(1R,5R)-8-[(4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]thiourea |
|---|---|
| PubChem CID | 50937819 |
| Molecular Formula | C23H28FN3S |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 1-(2-ethylphenyl)-3-[(1R,5R)-8-[(4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]thiourea |
| SMILES | CCc1ccccc1NC(=S)NC1C[C@H]2CC[C@H](C1)N2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H28FN3S/c1-2-17-5-3-4-6-22(17)26-23(28)25-19-13-20-11-12-21(14-19)27(20)15-16-7-9-18(24)10-8-16/h3-10,19-21H,2,11-15H2,1H3,(H2,25,26,28)/t20-,21-/m1/s1 |
| InChIKey | JLAISTOLJYZJEH-NHCUHLMSSA-N |
| XLogP | 4.87 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|