C16H20ClFN2O — CID 68822844
2-chloro-N-[8-[(4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]acetamide (PubChem CID 68822844) has the molecular formula C16H20ClFN2O and a molecular weight of 310.80 g/mol. Its IUPAC name is 2-chloro-N-[8-[(4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]acetamide.
| Compound Name | 2-chloro-N-[8-[(4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]acetamide |
|---|---|
| PubChem CID | 68822844 |
| Molecular Formula | C16H20ClFN2O |
| Molecular Weight | 310.80 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-chloro-N-[8-[(4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]acetamide |
| SMILES | O=C(CCl)NC1CC2CCC(C1)N2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H20ClFN2O/c17-9-16(21)19-13-7-14-5-6-15(8-13)20(14)10-11-1-3-12(18)4-2-11/h1-4,13-15H,5-10H2,(H,19,21) |
| InChIKey | NJNAZWXBVJVRAO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.80 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|