C22H24FN3O3 — CID 98110213
N-[(1R,5R)-9-[(4-fluorophenyl)methyl]-9-azabicyclo[3.3.1]nonan-3-yl]-4-nitrobenzamide (PubChem CID 98110213) has the molecular formula C22H24FN3O3 and a molecular weight of 397.45 g/mol. Its IUPAC name is N-[(1R,5R)-9-[(4-fluorophenyl)methyl]-9-azabicyclo[3.3.1]nonan-3-yl]-4-nitrobenzamide.
| Compound Name | N-[(1R,5R)-9-[(4-fluorophenyl)methyl]-9-azabicyclo[3.3.1]nonan-3-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 98110213 |
| Molecular Formula | C22H24FN3O3 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-[(1R,5R)-9-[(4-fluorophenyl)methyl]-9-azabicyclo[3.3.1]nonan-3-yl]-4-nitrobenzamide |
| SMILES | O=C(NC1C[C@H]2CCC[C@H](C1)N2Cc1ccc(F)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H24FN3O3/c23-17-8-4-15(5-9-17)14-25-20-2-1-3-21(25)13-18(12-20)24-22(27)16-6-10-19(11-7-16)26(28)29/h4-11,18,20-21H,1-3,12-14H2,(H,24,27)/t20-,21-/m1/s1 |
| InChIKey | PQRMINZJTYRPDG-NHCUHLMSSA-N |
| XLogP | 4.05 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|