C21H24FN3S — CID 1461025
1-[(1R,5S)-8-[(4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-phenylthiourea (PubChem CID 1461025) has the molecular formula C21H24FN3S and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-[(1R,5S)-8-[(4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-phenylthiourea.
| Compound Name | 1-[(1R,5S)-8-[(4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-phenylthiourea |
|---|---|
| PubChem CID | 1461025 |
| Molecular Formula | C21H24FN3S |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-[(1R,5S)-8-[(4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-phenylthiourea |
| SMILES | Fc1ccc(CN2[C@@H]3CC[C@H]2CC(NC(=S)Nc2ccccc2)C3)cc1 |
| InChI | InChI=1S/C21H24FN3S/c22-16-8-6-15(7-9-16)14-25-19-10-11-20(25)13-18(12-19)24-21(26)23-17-4-2-1-3-5-17/h1-9,18-20H,10-14H2,(H2,23,24,26)/t18?,19-,20+ |
| InChIKey | XVZAMGDQVNVNSU-IHWFROFDSA-N |
| XLogP | 4.31 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|