C24H31N3S — CID 1461819
1-[(1S,5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl]-3-(3,4-dimethylphenyl)thiourea (PubChem CID 1461819) has the molecular formula C24H31N3S and a molecular weight of 393.60 g/mol. Its IUPAC name is 1-[(1S,5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl]-3-(3,4-dimethylphenyl)thiourea.
| Compound Name | 1-[(1S,5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl]-3-(3,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 1461819 |
| Molecular Formula | C24H31N3S |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 1-[(1S,5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl]-3-(3,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NC2C[C@@H]3CCC[C@@H](C2)N3Cc2ccccc2)cc1C |
| InChI | InChI=1S/C24H31N3S/c1-17-11-12-20(13-18(17)2)25-24(28)26-21-14-22-9-6-10-23(15-21)27(22)16-19-7-4-3-5-8-19/h3-5,7-8,11-13,21-23H,6,9-10,14-16H2,1-2H3,(H2,25,26,28)/t22-,23-/m0/s1 |
| InChIKey | AWEAYUXTOXOPFE-GOTSBHOMSA-N |
| XLogP | 5.18 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|