C20H30N3S+ — CID 7389689
1-[(1R,5S)-9-cyclopropyl-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-(3,4-dimethylphenyl)thiourea (PubChem CID 7389689) has the molecular formula C20H30N3S+ and a molecular weight of 344.55 g/mol. Its IUPAC name is 1-[(1R,5S)-9-cyclopropyl-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-(3,4-dimethylphenyl)thiourea.
| Compound Name | 1-[(1R,5S)-9-cyclopropyl-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-(3,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 7389689 |
| Molecular Formula | C20H30N3S+ |
| Molecular Weight | 344.55 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-[(1R,5S)-9-cyclopropyl-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-(3,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NC2C[C@H]3CCC[C@@H](C2)[NH+]3C2CC2)cc1C |
| InChI | InChI=1S/C20H29N3S/c1-13-6-7-15(10-14(13)2)21-20(24)22-16-11-18-4-3-5-19(12-16)23(18)17-8-9-17/h6-7,10,16-19H,3-5,8-9,11-12H2,1-2H3,(H2,21,22,24)/p+1/t16?,18-,19+ |
| InChIKey | LVWKBDNUMXTIGX-JLYLLQBASA-O |
| XLogP | 2.72 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.55 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|