C18H26N3S+ — CID 7389662
1-[(1R,5S)-9-cyclopropyl-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-phenylthiourea (PubChem CID 7389662) has the molecular formula C18H26N3S+ and a molecular weight of 316.49 g/mol. Its IUPAC name is 1-[(1R,5S)-9-cyclopropyl-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-phenylthiourea.
| Compound Name | 1-[(1R,5S)-9-cyclopropyl-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-phenylthiourea |
|---|---|
| PubChem CID | 7389662 |
| Molecular Formula | C18H26N3S+ |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-[(1R,5S)-9-cyclopropyl-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-phenylthiourea |
| SMILES | S=C(Nc1ccccc1)NC1C[C@H]2CCC[C@@H](C1)[NH+]2C1CC1 |
| InChI | InChI=1S/C18H25N3S/c22-18(19-13-5-2-1-3-6-13)20-14-11-16-7-4-8-17(12-14)21(16)15-9-10-15/h1-3,5-6,14-17H,4,7-12H2,(H2,19,20,22)/p+1/t14?,16-,17+ |
| InChIKey | RSUHUEUPLLOEOC-ZXFUBFMLSA-O |
| XLogP | 2.10 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|