C24H32N3S+ — CID 7389804
1-[(1R,5S)-9-benzyl-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-(3,5-dimethylphenyl)thiourea (PubChem CID 7389804) has the molecular formula C24H32N3S+ and a molecular weight of 394.61 g/mol. Its IUPAC name is 1-[(1R,5S)-9-benzyl-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-(3,5-dimethylphenyl)thiourea.
| Compound Name | 1-[(1R,5S)-9-benzyl-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-(3,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 7389804 |
| Molecular Formula | C24H32N3S+ |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 1-[(1R,5S)-9-benzyl-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-(3,5-dimethylphenyl)thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)NC2C[C@H]3CCC[C@@H](C2)[NH+]3Cc2ccccc2)c1 |
| InChI | InChI=1S/C24H31N3S/c1-17-11-18(2)13-20(12-17)25-24(28)26-21-14-22-9-6-10-23(15-21)27(22)16-19-7-4-3-5-8-19/h3-5,7-8,11-13,21-23H,6,9-10,14-16H2,1-2H3,(H2,25,26,28)/p+1/t21?,22-,23+ |
| InChIKey | RCFJPAORUQWPHZ-NOTZXAQLSA-O |
| XLogP | 3.76 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|