C20H32N3O+ — CID 50937696
3-[(1R,5R)-9-benzyl-9-azoniabicyclo[3.3.1]nonan-3-yl]-1,1-diethylurea (PubChem CID 50937696) has the molecular formula C20H32N3O+ and a molecular weight of 330.50 g/mol. Its IUPAC name is 3-[(1R,5R)-9-benzyl-9-azoniabicyclo[3.3.1]nonan-3-yl]-1,1-diethylurea.
| Compound Name | 3-[(1R,5R)-9-benzyl-9-azoniabicyclo[3.3.1]nonan-3-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 50937696 |
| Molecular Formula | C20H32N3O+ |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | 3-[(1R,5R)-9-benzyl-9-azoniabicyclo[3.3.1]nonan-3-yl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NC1C[C@H]2CCC[C@H](C1)[NH+]2Cc1ccccc1 |
| InChI | InChI=1S/C20H31N3O/c1-3-22(4-2)20(24)21-17-13-18-11-8-12-19(14-17)23(18)15-16-9-6-5-7-10-16/h5-7,9-10,17-19H,3-4,8,11-15H2,1-2H3,(H,21,24)/p+1/t18-,19-/m1/s1 |
| InChIKey | VBNOHHLYJMSZEV-RTBURBONSA-O |
| XLogP | 2.21 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |