C23H30N3S+ — CID 11901094
1-[(1R,5S)-9-[(4-methylphenyl)methyl]-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-phenylthiourea (PubChem CID 11901094) has the molecular formula C23H30N3S+ and a molecular weight of 380.58 g/mol. Its IUPAC name is 1-[(1R,5S)-9-[(4-methylphenyl)methyl]-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-phenylthiourea.
| Compound Name | 1-[(1R,5S)-9-[(4-methylphenyl)methyl]-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-phenylthiourea |
|---|---|
| PubChem CID | 11901094 |
| Molecular Formula | C23H30N3S+ |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 1-[(1R,5S)-9-[(4-methylphenyl)methyl]-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-phenylthiourea |
| SMILES | Cc1ccc(C[NH+]2[C@@H]3CCC[C@H]2CC(NC(=S)Nc2ccccc2)C3)cc1 |
| InChI | InChI=1S/C23H29N3S/c1-17-10-12-18(13-11-17)16-26-21-8-5-9-22(26)15-20(14-21)25-23(27)24-19-6-3-2-4-7-19/h2-4,6-7,10-13,20-22H,5,8-9,14-16H2,1H3,(H2,24,25,27)/p+1/t20?,21-,22+ |
| InChIKey | ZNKVDBASFUVEAO-FRIKZZABSA-O |
| XLogP | 3.45 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|